C8H14ClN3O3 — CID 43566494
2-chloro-N-[[2-(ethylamino)-2-oxoethyl]carbamoyl]propanamide (PubChem CID 43566494) has the molecular formula C8H14ClN3O3 and a molecular weight of 235.67 g/mol. Its IUPAC name is 2-chloro-N-[[2-(ethylamino)-2-oxoethyl]carbamoyl]propanamide.
| Compound Name | 2-chloro-N-[[2-(ethylamino)-2-oxoethyl]carbamoyl]propanamide |
|---|---|
| PubChem CID | 43566494 |
| Molecular Formula | C8H14ClN3O3 |
| Molecular Weight | 235.67 g/mol |
| Exact Mass | 235.07 |
| IUPAC Name | 2-chloro-N-[[2-(ethylamino)-2-oxoethyl]carbamoyl]propanamide |
| SMILES | CCNC(=O)CNC(=O)NC(=O)C(C)Cl |
| InChI | InChI=1S/C8H14ClN3O3/c1-3-10-6(13)4-11-8(15)12-7(14)5(2)9/h5H,3-4H2,1-2H3,(H,10,13)(H2,11,12,14,15) |
| InChIKey | XQFHCWOGQCZSEB-UHFFFAOYSA-N |
| XLogP | -0.42 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.67 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|