C9H16ClN3O3 — CID 106239873
5-(2-chloropropanoylcarbamoylamino)pentanamide (PubChem CID 106239873) has the molecular formula C9H16ClN3O3 and a molecular weight of 249.70 g/mol. Its IUPAC name is 5-(2-chloropropanoylcarbamoylamino)pentanamide.
| Compound Name | 5-(2-chloropropanoylcarbamoylamino)pentanamide |
|---|---|
| PubChem CID | 106239873 |
| Molecular Formula | C9H16ClN3O3 |
| Molecular Weight | 249.70 g/mol |
| Exact Mass | 249.09 |
| IUPAC Name | 5-(2-chloropropanoylcarbamoylamino)pentanamide |
| SMILES | CC(Cl)C(=O)NC(=O)NCCCCC(N)=O |
| InChI | InChI=1S/C9H16ClN3O3/c1-6(10)8(15)13-9(16)12-5-3-2-4-7(11)14/h6H,2-5H2,1H3,(H2,11,14)(H2,12,13,15,16) |
| InChIKey | UCOPJAUELRSRMU-UHFFFAOYSA-N |
| XLogP | 0.10 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.70 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|