C11H21ClN2O2 — CID 63837506
2-chloro-N-(3-ethylpentan-2-ylcarbamoyl)propanamide (PubChem CID 63837506) has the molecular formula C11H21ClN2O2 and a molecular weight of 248.75 g/mol. Its IUPAC name is 2-chloro-N-(3-ethylpentan-2-ylcarbamoyl)propanamide.
| Compound Name | 2-chloro-N-(3-ethylpentan-2-ylcarbamoyl)propanamide |
|---|---|
| PubChem CID | 63837506 |
| Molecular Formula | C11H21ClN2O2 |
| Molecular Weight | 248.75 g/mol |
| Exact Mass | 248.13 |
| IUPAC Name | 2-chloro-N-(3-ethylpentan-2-ylcarbamoyl)propanamide |
| SMILES | CCC(CC)C(C)NC(=O)NC(=O)C(C)Cl |
| InChI | InChI=1S/C11H21ClN2O2/c1-5-9(6-2)8(4)13-11(16)14-10(15)7(3)12/h7-9H,5-6H2,1-4H3,(H2,13,14,15,16) |
| InChIKey | NYEQUQIXDITZGQ-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.75 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|