C14H19ClN2O2 — CID 106275818
3-[(2-chloro-2-phenylacetyl)amino]-N,2,2-trimethylpropanamide (PubChem CID 106275818) has the molecular formula C14H19ClN2O2 and a molecular weight of 282.77 g/mol. Its IUPAC name is 3-[(2-chloro-2-phenylacetyl)amino]-N,2,2-trimethylpropanamide.
| Compound Name | 3-[(2-chloro-2-phenylacetyl)amino]-N,2,2-trimethylpropanamide |
|---|---|
| PubChem CID | 106275818 |
| Molecular Formula | C14H19ClN2O2 |
| Molecular Weight | 282.77 g/mol |
| Exact Mass | 282.11 |
| IUPAC Name | 3-[(2-chloro-2-phenylacetyl)amino]-N,2,2-trimethylpropanamide |
| SMILES | CNC(=O)C(C)(C)CNC(=O)C(Cl)c1ccccc1 |
| InChI | InChI=1S/C14H19ClN2O2/c1-14(2,13(19)16-3)9-17-12(18)11(15)10-7-5-4-6-8-10/h4-8,11H,9H2,1-3H3,(H,16,19)(H,17,18) |
| InChIKey | PYXMDTBTSVCLGB-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.77 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|