C17H28N4O2 — CID 109408599
3-[[N-(3-hydroxy-2-phenylpropyl)-N'-methylcarbamimidoyl]amino]-N,2,2-trimethylpropanamide (PubChem CID 109408599) has the molecular formula C17H28N4O2 and a molecular weight of 320.44 g/mol. Its IUPAC name is 3-[[N-(3-hydroxy-2-phenylpropyl)-N'-methylcarbamimidoyl]amino]-N,2,2-trimethylpropanamide.
| Compound Name | 3-[[N-(3-hydroxy-2-phenylpropyl)-N'-methylcarbamimidoyl]amino]-N,2,2-trimethylpropanamide |
|---|---|
| PubChem CID | 109408599 |
| Molecular Formula | C17H28N4O2 |
| Molecular Weight | 320.44 g/mol |
| Exact Mass | 320.22 |
| IUPAC Name | 3-[[N-(3-hydroxy-2-phenylpropyl)-N'-methylcarbamimidoyl]amino]-N,2,2-trimethylpropanamide |
| SMILES | C/N=C(/NCC(CO)c1ccccc1)NCC(C)(C)C(=O)NC |
| InChI | InChI=1S/C17H28N4O2/c1-17(2,15(23)18-3)12-21-16(19-4)20-10-14(11-22)13-8-6-5-7-9-13/h5-9,14,22H,10-12H2,1-4H3,(H,18,23)(H2,19,20,21) |
| InChIKey | KNJAAGNYEFLGHW-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 85.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.44 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|