C13H17ClN2O2 — CID 114167195
3-[(2-chloro-2-phenylacetyl)amino]-2,2-dimethylpropanamide (PubChem CID 114167195) has the molecular formula C13H17ClN2O2 and a molecular weight of 268.74 g/mol. Its IUPAC name is 3-[(2-chloro-2-phenylacetyl)amino]-2,2-dimethylpropanamide.
| Compound Name | 3-[(2-chloro-2-phenylacetyl)amino]-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 114167195 |
| Molecular Formula | C13H17ClN2O2 |
| Molecular Weight | 268.74 g/mol |
| Exact Mass | 268.10 |
| IUPAC Name | 3-[(2-chloro-2-phenylacetyl)amino]-2,2-dimethylpropanamide |
| SMILES | CC(C)(CNC(=O)C(Cl)c1ccccc1)C(N)=O |
| InChI | InChI=1S/C13H17ClN2O2/c1-13(2,12(15)18)8-16-11(17)10(14)9-6-4-3-5-7-9/h3-7,10H,8H2,1-2H3,(H2,15,18)(H,16,17) |
| InChIKey | BKBBBVBTDNNZHV-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.74 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|