C16H25N3O2 — CID 95570545
2,2-dimethyl-3-[[(2R)-2-phenylbutyl]carbamoylamino]propanamide (PubChem CID 95570545) has the molecular formula C16H25N3O2 and a molecular weight of 291.39 g/mol. Its IUPAC name is 2,2-dimethyl-3-[[(2R)-2-phenylbutyl]carbamoylamino]propanamide.
| Compound Name | 2,2-dimethyl-3-[[(2R)-2-phenylbutyl]carbamoylamino]propanamide |
|---|---|
| PubChem CID | 95570545 |
| Molecular Formula | C16H25N3O2 |
| Molecular Weight | 291.39 g/mol |
| Exact Mass | 291.19 |
| IUPAC Name | 2,2-dimethyl-3-[[(2R)-2-phenylbutyl]carbamoylamino]propanamide |
| SMILES | CC[C@@H](CNC(=O)NCC(C)(C)C(N)=O)c1ccccc1 |
| InChI | InChI=1S/C16H25N3O2/c1-4-12(13-8-6-5-7-9-13)10-18-15(21)19-11-16(2,3)14(17)20/h5-9,12H,4,10-11H2,1-3H3,(H2,17,20)(H2,18,19,21)/t12-/m0/s1 |
| InChIKey | ZICIHCUMUSKUJP-LBPRGKRZSA-N |
| XLogP | 1.99 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.39 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |