C17H28N2O — CID 112840322
1-(2,2-dimethylpropyl)-3-(3-methyl-2-phenylbutyl)urea (PubChem CID 112840322) has the molecular formula C17H28N2O and a molecular weight of 276.42 g/mol. Its IUPAC name is 1-(2,2-dimethylpropyl)-3-(3-methyl-2-phenylbutyl)urea.
| Compound Name | 1-(2,2-dimethylpropyl)-3-(3-methyl-2-phenylbutyl)urea |
|---|---|
| PubChem CID | 112840322 |
| Molecular Formula | C17H28N2O |
| Molecular Weight | 276.42 g/mol |
| Exact Mass | 276.22 |
| IUPAC Name | 1-(2,2-dimethylpropyl)-3-(3-methyl-2-phenylbutyl)urea |
| SMILES | CC(C)C(CNC(=O)NCC(C)(C)C)c1ccccc1 |
| InChI | InChI=1S/C17H28N2O/c1-13(2)15(14-9-7-6-8-10-14)11-18-16(20)19-12-17(3,4)5/h6-10,13,15H,11-12H2,1-5H3,(H2,18,19,20) |
| InChIKey | TUNIOHAQGJEUPC-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.42 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |