C11H23N3O2S — CID 103822776
3-(3-methoxypropylcarbamothioylamino)-N,2,2-trimethylpropanamide (PubChem CID 103822776) has the molecular formula C11H23N3O2S and a molecular weight of 261.39 g/mol. Its IUPAC name is 3-(3-methoxypropylcarbamothioylamino)-N,2,2-trimethylpropanamide.
| Compound Name | 3-(3-methoxypropylcarbamothioylamino)-N,2,2-trimethylpropanamide |
|---|---|
| PubChem CID | 103822776 |
| Molecular Formula | C11H23N3O2S |
| Molecular Weight | 261.39 g/mol |
| Exact Mass | 261.15 |
| IUPAC Name | 3-(3-methoxypropylcarbamothioylamino)-N,2,2-trimethylpropanamide |
| SMILES | CNC(=O)C(C)(C)CNC(=S)NCCCOC |
| InChI | InChI=1S/C11H23N3O2S/c1-11(2,9(15)12-3)8-14-10(17)13-6-5-7-16-4/h5-8H2,1-4H3,(H,12,15)(H2,13,14,17) |
| InChIKey | ALOXCMNCTUTMIO-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 62.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.39 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|