C8H14F4N2S — CID 103520307
1-(2-methylpropyl)-3-(2,2,3,3-tetrafluoropropyl)thiourea (PubChem CID 103520307) has the molecular formula C8H14F4N2S and a molecular weight of 246.27 g/mol. Its IUPAC name is 1-(2-methylpropyl)-3-(2,2,3,3-tetrafluoropropyl)thiourea.
| Compound Name | 1-(2-methylpropyl)-3-(2,2,3,3-tetrafluoropropyl)thiourea |
|---|---|
| PubChem CID | 103520307 |
| Molecular Formula | C8H14F4N2S |
| Molecular Weight | 246.27 g/mol |
| Exact Mass | 246.08 |
| IUPAC Name | 1-(2-methylpropyl)-3-(2,2,3,3-tetrafluoropropyl)thiourea |
| SMILES | CC(C)CNC(=S)NCC(F)(F)C(F)F |
| InChI | InChI=1S/C8H14F4N2S/c1-5(2)3-13-7(15)14-4-8(11,12)6(9)10/h5-6H,3-4H2,1-2H3,(H2,13,14,15) |
| InChIKey | QALXXTNQKSRMRH-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.27 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|