C7H16N2OS — CID 5061824
1-(2-hydroxyethyl)-3-(2-methylpropyl)thiourea (PubChem CID 5061824) has the molecular formula C7H16N2OS and a molecular weight of 176.28 g/mol. Its IUPAC name is 1-(2-hydroxyethyl)-3-(2-methylpropyl)thiourea.
| Compound Name | 1-(2-hydroxyethyl)-3-(2-methylpropyl)thiourea |
|---|---|
| PubChem CID | 5061824 |
| Molecular Formula | C7H16N2OS |
| Molecular Weight | 176.28 g/mol |
| Exact Mass | 176.10 |
| IUPAC Name | 1-(2-hydroxyethyl)-3-(2-methylpropyl)thiourea |
| SMILES | CC(C)CNC(=S)NCCO |
| InChI | InChI=1S/C7H16N2OS/c1-6(2)5-9-7(11)8-3-4-10/h6,10H,3-5H2,1-2H3,(H2,8,9,11) |
| InChIKey | MVLKQOMVRZFOTL-UHFFFAOYSA-N |
| XLogP | 0.10 |
| TPSA | 44.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.28 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|