C13H22F8N3+ — CID 157068146
bis(2,2,3,3-tetrafluoropropylamino)methylidene-di(propan-2-yl)azanium (PubChem CID 157068146) has the molecular formula C13H22F8N3+ and a molecular weight of 372.32 g/mol. Its IUPAC name is bis(2,2,3,3-tetrafluoropropylamino)methylidene-di(propan-2-yl)azanium.
| Compound Name | bis(2,2,3,3-tetrafluoropropylamino)methylidene-di(propan-2-yl)azanium |
|---|---|
| PubChem CID | 157068146 |
| Molecular Formula | C13H22F8N3+ |
| Molecular Weight | 372.32 g/mol |
| Exact Mass | 372.17 |
| IUPAC Name | bis(2,2,3,3-tetrafluoropropylamino)methylidene-di(propan-2-yl)azanium |
| SMILES | CC(C)[N+](=C(NCC(F)(F)C(F)F)NCC(F)(F)C(F)F)C(C)C |
| InChI | InChI=1S/C13H21F8N3/c1-7(2)24(8(3)4)11(22-5-12(18,19)9(14)15)23-6-13(20,21)10(16)17/h7-10H,5-6H2,1-4H3,(H,22,23)/p+1 |
| InChIKey | SZWHNQQENVGUSI-UHFFFAOYSA-O |
| XLogP | 3.15 |
| TPSA | 27.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.32 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|