C7H12F4N2O — CID 106291111
1-ethyl-1-methyl-3-(2,2,3,3-tetrafluoropropyl)urea (PubChem CID 106291111) has the molecular formula C7H12F4N2O and a molecular weight of 216.18 g/mol. Its IUPAC name is 1-ethyl-1-methyl-3-(2,2,3,3-tetrafluoropropyl)urea.
| Compound Name | 1-ethyl-1-methyl-3-(2,2,3,3-tetrafluoropropyl)urea |
|---|---|
| PubChem CID | 106291111 |
| Molecular Formula | C7H12F4N2O |
| Molecular Weight | 216.18 g/mol |
| Exact Mass | 216.09 |
| IUPAC Name | 1-ethyl-1-methyl-3-(2,2,3,3-tetrafluoropropyl)urea |
| SMILES | CCN(C)C(=O)NCC(F)(F)C(F)F |
| InChI | InChI=1S/C7H12F4N2O/c1-3-13(2)6(14)12-4-7(10,11)5(8)9/h5H,3-4H2,1-2H3,(H,12,14) |
| InChIKey | AZTFOYZYBPRPBT-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.18 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|