C6H16N2O — CID 142235492
1,3-diethyl-1-methylurea;molecular hydrogen (PubChem CID 142235492) has the molecular formula C6H16N2O and a molecular weight of 132.21 g/mol. Its IUPAC name is 1,3-diethyl-1-methylurea;molecular hydrogen.
| Compound Name | 1,3-diethyl-1-methylurea;molecular hydrogen |
|---|---|
| PubChem CID | 142235492 |
| Molecular Formula | C6H16N2O |
| Molecular Weight | 132.21 g/mol |
| Exact Mass | 132.13 |
| IUPAC Name | 1,3-diethyl-1-methylurea;molecular hydrogen |
| SMILES | CCNC(=O)N(C)CC.[H][H] |
| InChI | InChI=1S/C6H14N2O.H2/c1-4-7-6(9)8(3)5-2;/h4-5H2,1-3H3,(H,7,9);1H |
| InChIKey | VSMUIQFIZYXCPU-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 132.21 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |