About 1,3-diethyl-1-methylurea;molecular hydrogen
1,3-diethyl-1-methylurea;molecular hydrogen (PubChem CID 142235492) has the molecular formula C6H16N2O
and a molecular weight of 132.21 g/mol. Its IUPAC name is 1,3-diethyl-1-methylurea;molecular hydrogen.
Molecular Properties
| Compound Name | 1,3-diethyl-1-methylurea;molecular hydrogen |
| PubChem CID | 142235492 |
| Molecular Formula | C6H16N2O |
| Molecular Weight | 132.21 g/mol |
| Exact Mass | 132.13 |
| IUPAC Name | 1,3-diethyl-1-methylurea;molecular hydrogen |
| SMILES | CCNC(=O)N(C)CC.[H][H] |
| InChI | InChI=1S/C6H14N2O.H2/c1-4-7-6(9)8(3)5-2;/h4-5H2,1-3H3,(H,7,9);1H |
| InChIKey | VSMUIQFIZYXCPU-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 132.21 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1,3-diethyl-1-methylurea;molecular hydrogen with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-diethyl-1-methylurea;molecular hydrogen?
The IUPAC name of 1,3-diethyl-1-methylurea;molecular hydrogen (CID 142235492) is 1,3-diethyl-1-methylurea;molecular hydrogen.
What is the SMILES notation for 1,3-diethyl-1-methylurea;molecular hydrogen?
The canonical SMILES for 1,3-diethyl-1-methylurea;molecular hydrogen is CCNC(=O)N(C)CC.[H][H].
What is the InChIKey of 1,3-diethyl-1-methylurea;molecular hydrogen?
The InChIKey is VSMUIQFIZYXCPU-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H14N2O.H2/c1-4-7-6(9)8(3)5-2;/h4-5H2,1-3H3,(H,7,9);1H.
What are the key properties of 1,3-diethyl-1-methylurea;molecular hydrogen?
1,3-diethyl-1-methylurea;molecular hydrogen has a molecular weight of 132.21 g/mol, XLogP of 0.91, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-diethyl-1-methylurea;molecular hydrogen is sourced from PubChem (CID 142235492), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).