C5H14N2O — CID 144978346
3-ethyl-1,1-dimethylurea;molecular hydrogen (PubChem CID 144978346) has the molecular formula C5H14N2O and a molecular weight of 118.18 g/mol. Its IUPAC name is 3-ethyl-1,1-dimethylurea;molecular hydrogen.
| Compound Name | 3-ethyl-1,1-dimethylurea;molecular hydrogen |
|---|---|
| PubChem CID | 144978346 |
| Molecular Formula | C5H14N2O |
| Molecular Weight | 118.18 g/mol |
| Exact Mass | 118.11 |
| IUPAC Name | 3-ethyl-1,1-dimethylurea;molecular hydrogen |
| SMILES | CCNC(=O)N(C)C.[H][H] |
| InChI | InChI=1S/C5H12N2O.H2/c1-4-6-5(8)7(2)3;/h4H2,1-3H3,(H,6,8);1H |
| InChIKey | DRRXIPFNHLXHSJ-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 118.18 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |