C9H20N2O2 — CID 115698202
3-ethyl-1-methyl-1-(2-propan-2-yloxyethyl)urea (PubChem CID 115698202) has the molecular formula C9H20N2O2 and a molecular weight of 188.27 g/mol. Its IUPAC name is 3-ethyl-1-methyl-1-(2-propan-2-yloxyethyl)urea.
| Compound Name | 3-ethyl-1-methyl-1-(2-propan-2-yloxyethyl)urea |
|---|---|
| PubChem CID | 115698202 |
| Molecular Formula | C9H20N2O2 |
| Molecular Weight | 188.27 g/mol |
| Exact Mass | 188.15 |
| IUPAC Name | 3-ethyl-1-methyl-1-(2-propan-2-yloxyethyl)urea |
| SMILES | CCNC(=O)N(C)CCOC(C)C |
| InChI | InChI=1S/C9H20N2O2/c1-5-10-9(12)11(4)6-7-13-8(2)3/h8H,5-7H2,1-4H3,(H,10,12) |
| InChIKey | ALOYJKDJQSTIEZ-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.27 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |