C12H24N2O4 — CID 81061955
(2R)-3-methyl-2-[[methyl(2-propan-2-yloxyethyl)carbamoyl]amino]butanoic acid (PubChem CID 81061955) has the molecular formula C12H24N2O4 and a molecular weight of 260.33 g/mol. Its IUPAC name is (2R)-3-methyl-2-[[methyl(2-propan-2-yloxyethyl)carbamoyl]amino]butanoic acid.
| Compound Name | (2R)-3-methyl-2-[[methyl(2-propan-2-yloxyethyl)carbamoyl]amino]butanoic acid |
|---|---|
| PubChem CID | 81061955 |
| Molecular Formula | C12H24N2O4 |
| Molecular Weight | 260.33 g/mol |
| Exact Mass | 260.17 |
| IUPAC Name | (2R)-3-methyl-2-[[methyl(2-propan-2-yloxyethyl)carbamoyl]amino]butanoic acid |
| SMILES | CC(C)OCCN(C)C(=O)N[C@@H](C(=O)O)C(C)C |
| InChI | InChI=1S/C12H24N2O4/c1-8(2)10(11(15)16)13-12(17)14(5)6-7-18-9(3)4/h8-10H,6-7H2,1-5H3,(H,13,17)(H,15,16)/t10-/m1/s1 |
| InChIKey | STXCGCLOTAYRIE-SNVBAGLBSA-N |
| XLogP | 1.16 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.33 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |