C7H17N3O2 — CID 81062243
3-amino-1-methyl-1-(2-propan-2-yloxyethyl)urea (PubChem CID 81062243) has the molecular formula C7H17N3O2 and a molecular weight of 175.23 g/mol. Its IUPAC name is 3-amino-1-methyl-1-(2-propan-2-yloxyethyl)urea.
| Compound Name | 3-amino-1-methyl-1-(2-propan-2-yloxyethyl)urea |
|---|---|
| PubChem CID | 81062243 |
| Molecular Formula | C7H17N3O2 |
| Molecular Weight | 175.23 g/mol |
| Exact Mass | 175.13 |
| IUPAC Name | 3-amino-1-methyl-1-(2-propan-2-yloxyethyl)urea |
| SMILES | CC(C)OCCN(C)C(=O)NN |
| InChI | InChI=1S/C7H17N3O2/c1-6(2)12-5-4-10(3)7(11)9-8/h6H,4-5,8H2,1-3H3,(H,9,11) |
| InChIKey | AQNXLAMEIBUMPA-UHFFFAOYSA-N |
| XLogP | -0.07 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.23 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|