C9H21N3O3 — CID 81068250
hydrazinyl 3-[methyl(2-propan-2-yloxyethyl)amino]propanoate (PubChem CID 81068250) has the molecular formula C9H21N3O3 and a molecular weight of 219.28 g/mol. Its IUPAC name is hydrazinyl 3-[methyl(2-propan-2-yloxyethyl)amino]propanoate.
| Compound Name | hydrazinyl 3-[methyl(2-propan-2-yloxyethyl)amino]propanoate |
|---|---|
| PubChem CID | 81068250 |
| Molecular Formula | C9H21N3O3 |
| Molecular Weight | 219.28 g/mol |
| Exact Mass | 219.16 |
| IUPAC Name | hydrazinyl 3-[methyl(2-propan-2-yloxyethyl)amino]propanoate |
| SMILES | CC(C)OCCN(C)CCC(=O)ONN |
| InChI | InChI=1S/C9H21N3O3/c1-8(2)14-7-6-12(3)5-4-9(13)15-11-10/h8,11H,4-7,10H2,1-3H3 |
| InChIKey | CFYMUIYXZCDNOE-UHFFFAOYSA-N |
| XLogP | -0.35 |
| TPSA | 76.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.28 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|