C9H17N3O4 — CID 61198805
(2S)-2-[[(2-amino-2-oxoethyl)-methylcarbamoyl]amino]-3-methylbutanoic acid (PubChem CID 61198805) has the molecular formula C9H17N3O4 and a molecular weight of 231.25 g/mol. Its IUPAC name is (2S)-2-[[(2-amino-2-oxoethyl)-methylcarbamoyl]amino]-3-methylbutanoic acid.
| Compound Name | (2S)-2-[[(2-amino-2-oxoethyl)-methylcarbamoyl]amino]-3-methylbutanoic acid |
|---|---|
| PubChem CID | 61198805 |
| Molecular Formula | C9H17N3O4 |
| Molecular Weight | 231.25 g/mol |
| Exact Mass | 231.12 |
| IUPAC Name | (2S)-2-[[(2-amino-2-oxoethyl)-methylcarbamoyl]amino]-3-methylbutanoic acid |
| SMILES | CC(C)[C@H](NC(=O)N(C)CC(N)=O)C(=O)O |
| InChI | InChI=1S/C9H17N3O4/c1-5(2)7(8(14)15)11-9(16)12(3)4-6(10)13/h5,7H,4H2,1-3H3,(H2,10,13)(H,11,16)(H,14,15)/t7-/m0/s1 |
| InChIKey | BEVLYFSLZNZOCQ-ZETCQYMHSA-N |
| XLogP | -0.78 |
| TPSA | 112.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.25 |
| LogP ≤ 5 | -0.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |