C7H13N3OS — CID 115571221
2-(cyclopropylcarbamothioylamino)-N-methylacetamide (PubChem CID 115571221) has the molecular formula C7H13N3OS and a molecular weight of 187.27 g/mol. Its IUPAC name is 2-(cyclopropylcarbamothioylamino)-N-methylacetamide.
| Compound Name | 2-(cyclopropylcarbamothioylamino)-N-methylacetamide |
|---|---|
| PubChem CID | 115571221 |
| Molecular Formula | C7H13N3OS |
| Molecular Weight | 187.27 g/mol |
| Exact Mass | 187.08 |
| IUPAC Name | 2-(cyclopropylcarbamothioylamino)-N-methylacetamide |
| SMILES | CNC(=O)CNC(=S)NC1CC1 |
| InChI | InChI=1S/C7H13N3OS/c1-8-6(11)4-9-7(12)10-5-2-3-5/h5H,2-4H2,1H3,(H,8,11)(H2,9,10,12) |
| InChIKey | VZSSSZXHXWGBLL-UHFFFAOYSA-N |
| XLogP | -0.64 |
| TPSA | 53.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.27 |
| LogP ≤ 5 | -0.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|