C9H17N3OS — CID 116507386
2-(cyclopentylcarbamothioylamino)-N-methylacetamide (PubChem CID 116507386) has the molecular formula C9H17N3OS and a molecular weight of 215.32 g/mol. Its IUPAC name is 2-(cyclopentylcarbamothioylamino)-N-methylacetamide.
| Compound Name | 2-(cyclopentylcarbamothioylamino)-N-methylacetamide |
|---|---|
| PubChem CID | 116507386 |
| Molecular Formula | C9H17N3OS |
| Molecular Weight | 215.32 g/mol |
| Exact Mass | 215.11 |
| IUPAC Name | 2-(cyclopentylcarbamothioylamino)-N-methylacetamide |
| SMILES | CNC(=O)CNC(=S)NC1CCCC1 |
| InChI | InChI=1S/C9H17N3OS/c1-10-8(13)6-11-9(14)12-7-4-2-3-5-7/h7H,2-6H2,1H3,(H,10,13)(H2,11,12,14) |
| InChIKey | ZFTXXIOFKKYDTF-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 53.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.32 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|