C8H16N4S2 — CID 8789272
1-cyclopentyl-3-(methylcarbamothioylamino)thiourea (PubChem CID 8789272) has the molecular formula C8H16N4S2 and a molecular weight of 232.38 g/mol. Its IUPAC name is 1-cyclopentyl-3-(methylcarbamothioylamino)thiourea.
| Compound Name | 1-cyclopentyl-3-(methylcarbamothioylamino)thiourea |
|---|---|
| PubChem CID | 8789272 |
| Molecular Formula | C8H16N4S2 |
| Molecular Weight | 232.38 g/mol |
| Exact Mass | 232.08 |
| IUPAC Name | 1-cyclopentyl-3-(methylcarbamothioylamino)thiourea |
| SMILES | CNC(=S)NNC(=S)NC1CCCC1 |
| InChI | InChI=1S/C8H16N4S2/c1-9-7(13)11-12-8(14)10-6-4-2-3-5-6/h6H,2-5H2,1H3,(H2,9,11,13)(H2,10,12,14) |
| InChIKey | CIVVAMVNHXSZTQ-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 48.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.38 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|