C13H26N4S2 — CID 8789664
1-cyclohexyl-3-(3-methylbutylcarbamothioylamino)thiourea (PubChem CID 8789664) has the molecular formula C13H26N4S2 and a molecular weight of 302.51 g/mol. Its IUPAC name is 1-cyclohexyl-3-(3-methylbutylcarbamothioylamino)thiourea.
| Compound Name | 1-cyclohexyl-3-(3-methylbutylcarbamothioylamino)thiourea |
|---|---|
| PubChem CID | 8789664 |
| Molecular Formula | C13H26N4S2 |
| Molecular Weight | 302.51 g/mol |
| Exact Mass | 302.16 |
| IUPAC Name | 1-cyclohexyl-3-(3-methylbutylcarbamothioylamino)thiourea |
| SMILES | CC(C)CCNC(=S)NNC(=S)NC1CCCCC1 |
| InChI | InChI=1S/C13H26N4S2/c1-10(2)8-9-14-12(18)16-17-13(19)15-11-6-4-3-5-7-11/h10-11H,3-9H2,1-2H3,(H2,14,16,18)(H2,15,17,19) |
| InChIKey | VDCPOCVWXQDPRS-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 48.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.51 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|