C11H20IN5OS — CID 119159369
N'-[(5-propan-2-yl-1,3,4-thiadiazol-2-yl)methyl]morpholine-4-carboximidamide;hydroiodide (PubChem CID 119159369) has the molecular formula C11H20IN5OS and a molecular weight of 397.29 g/mol. Its IUPAC name is N'-[(5-propan-2-yl-1,3,4-thiadiazol-2-yl)methyl]morpholine-4-carboximidamide;hydroiodide.
| Compound Name | N'-[(5-propan-2-yl-1,3,4-thiadiazol-2-yl)methyl]morpholine-4-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 119159369 |
| Molecular Formula | C11H20IN5OS |
| Molecular Weight | 397.29 g/mol |
| Exact Mass | 397.04 |
| IUPAC Name | N'-[(5-propan-2-yl-1,3,4-thiadiazol-2-yl)methyl]morpholine-4-carboximidamide;hydroiodide |
| SMILES | CC(C)c1nnc(C/N=C(\N)N2CCOCC2)s1.I |
| InChI | InChI=1S/C11H19N5OS.HI/c1-8(2)10-15-14-9(18-10)7-13-11(12)16-3-5-17-6-4-16;/h8H,3-7H2,1-2H3,(H2,12,13);1H |
| InChIKey | GACAHIVFIVGXAA-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 76.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.29 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|