C10H14Cl2IN3OS — CID 86781929
N'-[(2,5-dichlorothiophen-3-yl)methyl]morpholine-4-carboximidamide;hydroiodide (PubChem CID 86781929) has the molecular formula C10H14Cl2IN3OS and a molecular weight of 422.12 g/mol. Its IUPAC name is N'-[(2,5-dichlorothiophen-3-yl)methyl]morpholine-4-carboximidamide;hydroiodide.
| Compound Name | N'-[(2,5-dichlorothiophen-3-yl)methyl]morpholine-4-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 86781929 |
| Molecular Formula | C10H14Cl2IN3OS |
| Molecular Weight | 422.12 g/mol |
| Exact Mass | 420.93 |
| IUPAC Name | N'-[(2,5-dichlorothiophen-3-yl)methyl]morpholine-4-carboximidamide;hydroiodide |
| SMILES | I.N/C(=N\Cc1cc(Cl)sc1Cl)N1CCOCC1 |
| InChI | InChI=1S/C10H13Cl2N3OS.HI/c11-8-5-7(9(12)17-8)6-14-10(13)15-1-3-16-4-2-15;/h5H,1-4,6H2,(H2,13,14);1H |
| InChIKey | YOVGNFMBXBPCNM-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 50.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.12 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|