C16H24BrIN4O2 — CID 119934022
N'-[(4-bromo-2-morpholin-4-ylphenyl)methyl]morpholine-4-carboximidamide;hydroiodide (PubChem CID 119934022) has the molecular formula C16H24BrIN4O2 and a molecular weight of 511.20 g/mol. Its IUPAC name is N'-[(4-bromo-2-morpholin-4-ylphenyl)methyl]morpholine-4-carboximidamide;hydroiodide.
| Compound Name | N'-[(4-bromo-2-morpholin-4-ylphenyl)methyl]morpholine-4-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 119934022 |
| Molecular Formula | C16H24BrIN4O2 |
| Molecular Weight | 511.20 g/mol |
| Exact Mass | 510.01 |
| IUPAC Name | N'-[(4-bromo-2-morpholin-4-ylphenyl)methyl]morpholine-4-carboximidamide;hydroiodide |
| SMILES | I.N/C(=N\Cc1ccc(Br)cc1N1CCOCC1)N1CCOCC1 |
| InChI | InChI=1S/C16H23BrN4O2.HI/c17-14-2-1-13(15(11-14)20-3-7-22-8-4-20)12-19-16(18)21-5-9-23-10-6-21;/h1-2,11H,3-10,12H2,(H2,18,19);1H |
| InChIKey | PBKOAJCMMXDAIC-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.20 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|