C11H13Br2N3 — CID 122095446
N'-[(2,5-dibromophenyl)methyl]azetidine-1-carboximidamide (PubChem CID 122095446) has the molecular formula C11H13Br2N3 and a molecular weight of 347.05 g/mol. Its IUPAC name is N'-[(2,5-dibromophenyl)methyl]azetidine-1-carboximidamide.
| Compound Name | N'-[(2,5-dibromophenyl)methyl]azetidine-1-carboximidamide |
|---|---|
| PubChem CID | 122095446 |
| Molecular Formula | C11H13Br2N3 |
| Molecular Weight | 347.05 g/mol |
| Exact Mass | 344.95 |
| IUPAC Name | N'-[(2,5-dibromophenyl)methyl]azetidine-1-carboximidamide |
| SMILES | N/C(=N\Cc1cc(Br)ccc1Br)N1CCC1 |
| InChI | InChI=1S/C11H13Br2N3/c12-9-2-3-10(13)8(6-9)7-15-11(14)16-4-1-5-16/h2-3,6H,1,4-5,7H2,(H2,14,15) |
| InChIKey | QDKGSBXOCUFZQR-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 41.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.05 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|