C11H13ClIN3 — CID 122095649
N'-[(4-chloro-2-iodophenyl)methyl]azetidine-1-carboximidamide (PubChem CID 122095649) has the molecular formula C11H13ClIN3 and a molecular weight of 349.60 g/mol. Its IUPAC name is N'-[(4-chloro-2-iodophenyl)methyl]azetidine-1-carboximidamide.
| Compound Name | N'-[(4-chloro-2-iodophenyl)methyl]azetidine-1-carboximidamide |
|---|---|
| PubChem CID | 122095649 |
| Molecular Formula | C11H13ClIN3 |
| Molecular Weight | 349.60 g/mol |
| Exact Mass | 348.98 |
| IUPAC Name | N'-[(4-chloro-2-iodophenyl)methyl]azetidine-1-carboximidamide |
| SMILES | N/C(=N\Cc1ccc(Cl)cc1I)N1CCC1 |
| InChI | InChI=1S/C11H13ClIN3/c12-9-3-2-8(10(13)6-9)7-15-11(14)16-4-1-5-16/h2-3,6H,1,4-5,7H2,(H2,14,15) |
| InChIKey | AQNXSWBHCHLVFE-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 41.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.60 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|