C15H22ClFN4O2S — CID 120727925
N'-[2-[(4-chloro-2-fluorophenyl)sulfonylamino]ethyl]azepane-1-carboximidamide (PubChem CID 120727925) has the molecular formula C15H22ClFN4O2S and a molecular weight of 376.89 g/mol. Its IUPAC name is N'-[2-[(4-chloro-2-fluorophenyl)sulfonylamino]ethyl]azepane-1-carboximidamide.
| Compound Name | N'-[2-[(4-chloro-2-fluorophenyl)sulfonylamino]ethyl]azepane-1-carboximidamide |
|---|---|
| PubChem CID | 120727925 |
| Molecular Formula | C15H22ClFN4O2S |
| Molecular Weight | 376.89 g/mol |
| Exact Mass | 376.11 |
| IUPAC Name | N'-[2-[(4-chloro-2-fluorophenyl)sulfonylamino]ethyl]azepane-1-carboximidamide |
| SMILES | N/C(=N\CCNS(=O)(=O)c1ccc(Cl)cc1F)N1CCCCCC1 |
| InChI | InChI=1S/C15H22ClFN4O2S/c16-12-5-6-14(13(17)11-12)24(22,23)20-8-7-19-15(18)21-9-3-1-2-4-10-21/h5-6,11,20H,1-4,7-10H2,(H2,18,19) |
| InChIKey | YVMUAZAPZSDPNZ-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 87.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.89 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|