C14H22ClIN4O2S2 — CID 120973878
N'-[2-[(4-chloro-2-methylphenyl)sulfonylamino]ethyl]thiomorpholine-4-carboximidamide;hydroiodide (PubChem CID 120973878) has the molecular formula C14H22ClIN4O2S2 and a molecular weight of 504.85 g/mol. Its IUPAC name is N'-[2-[(4-chloro-2-methylphenyl)sulfonylamino]ethyl]thiomorpholine-4-carboximidamide;hydroiodide.
| Compound Name | N'-[2-[(4-chloro-2-methylphenyl)sulfonylamino]ethyl]thiomorpholine-4-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 120973878 |
| Molecular Formula | C14H22ClIN4O2S2 |
| Molecular Weight | 504.85 g/mol |
| Exact Mass | 503.99 |
| IUPAC Name | N'-[2-[(4-chloro-2-methylphenyl)sulfonylamino]ethyl]thiomorpholine-4-carboximidamide;hydroiodide |
| SMILES | Cc1cc(Cl)ccc1S(=O)(=O)NCC/N=C(\N)N1CCSCC1.I |
| InChI | InChI=1S/C14H21ClN4O2S2.HI/c1-11-10-12(15)2-3-13(11)23(20,21)18-5-4-17-14(16)19-6-8-22-9-7-19;/h2-3,10,18H,4-9H2,1H3,(H2,16,17);1H |
| InChIKey | YFQGBLCSHLHJJB-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 87.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.85 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|