C12H17ClIN3 — CID 122082170
2-[(4-chloro-2-iodophenyl)methyl]-1,1,3,3-tetramethylguanidine (PubChem CID 122082170) has the molecular formula C12H17ClIN3 and a molecular weight of 365.65 g/mol. Its IUPAC name is 2-[(4-chloro-2-iodophenyl)methyl]-1,1,3,3-tetramethylguanidine.
| Compound Name | 2-[(4-chloro-2-iodophenyl)methyl]-1,1,3,3-tetramethylguanidine |
|---|---|
| PubChem CID | 122082170 |
| Molecular Formula | C12H17ClIN3 |
| Molecular Weight | 365.65 g/mol |
| Exact Mass | 365.02 |
| IUPAC Name | 2-[(4-chloro-2-iodophenyl)methyl]-1,1,3,3-tetramethylguanidine |
| SMILES | CN(C)C(=NCc1ccc(Cl)cc1I)N(C)C |
| InChI | InChI=1S/C12H17ClIN3/c1-16(2)12(17(3)4)15-8-9-5-6-10(13)7-11(9)14/h5-7H,8H2,1-4H3 |
| InChIKey | AXBREQCYFCVCTG-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 18.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.65 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|