C13H17F4N3 — CID 111044992
2-[[4-fluoro-2-(trifluoromethyl)phenyl]methyl]-1,1,3,3-tetramethylguanidine (PubChem CID 111044992) has the molecular formula C13H17F4N3 and a molecular weight of 291.29 g/mol. Its IUPAC name is 2-[[4-fluoro-2-(trifluoromethyl)phenyl]methyl]-1,1,3,3-tetramethylguanidine.
| Compound Name | 2-[[4-fluoro-2-(trifluoromethyl)phenyl]methyl]-1,1,3,3-tetramethylguanidine |
|---|---|
| PubChem CID | 111044992 |
| Molecular Formula | C13H17F4N3 |
| Molecular Weight | 291.29 g/mol |
| Exact Mass | 291.14 |
| IUPAC Name | 2-[[4-fluoro-2-(trifluoromethyl)phenyl]methyl]-1,1,3,3-tetramethylguanidine |
| SMILES | CN(C)C(=NCc1ccc(F)cc1C(F)(F)F)N(C)C |
| InChI | InChI=1S/C13H17F4N3/c1-19(2)12(20(3)4)18-8-9-5-6-10(14)7-11(9)13(15,16)17/h5-7H,8H2,1-4H3 |
| InChIKey | LPIKOFNPXLWXES-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 18.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.29 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|