C15H20F4IN3 — CID 111889314
1-ethyl-2-[[4-fluoro-2-(trifluoromethyl)phenyl]methyl]-3-(2-methylcyclopropyl)guanidine;hydroiodide (PubChem CID 111889314) has the molecular formula C15H20F4IN3 and a molecular weight of 445.24 g/mol. Its IUPAC name is 1-ethyl-2-[[4-fluoro-2-(trifluoromethyl)phenyl]methyl]-3-(2-methylcyclopropyl)guanidine;hydroiodide.
| Compound Name | 1-ethyl-2-[[4-fluoro-2-(trifluoromethyl)phenyl]methyl]-3-(2-methylcyclopropyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111889314 |
| Molecular Formula | C15H20F4IN3 |
| Molecular Weight | 445.24 g/mol |
| Exact Mass | 445.06 |
| IUPAC Name | 1-ethyl-2-[[4-fluoro-2-(trifluoromethyl)phenyl]methyl]-3-(2-methylcyclopropyl)guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccc(F)cc1C(F)(F)F)NC1CC1C.I |
| InChI | InChI=1S/C15H19F4N3.HI/c1-3-20-14(22-13-6-9(13)2)21-8-10-4-5-11(16)7-12(10)15(17,18)19;/h4-5,7,9,13H,3,6,8H2,1-2H3,(H2,20,21,22);1H |
| InChIKey | IKPAEULRCYGSRN-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.24 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|