C13H20ClFIN3 — CID 111812989
2-[2-(2-chloro-4-fluorophenyl)ethyl]-1,1,3,3-tetramethylguanidine;hydroiodide (PubChem CID 111812989) has the molecular formula C13H20ClFIN3 and a molecular weight of 399.68 g/mol. Its IUPAC name is 2-[2-(2-chloro-4-fluorophenyl)ethyl]-1,1,3,3-tetramethylguanidine;hydroiodide.
| Compound Name | 2-[2-(2-chloro-4-fluorophenyl)ethyl]-1,1,3,3-tetramethylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111812989 |
| Molecular Formula | C13H20ClFIN3 |
| Molecular Weight | 399.68 g/mol |
| Exact Mass | 399.04 |
| IUPAC Name | 2-[2-(2-chloro-4-fluorophenyl)ethyl]-1,1,3,3-tetramethylguanidine;hydroiodide |
| SMILES | CN(C)C(=NCCc1ccc(F)cc1Cl)N(C)C.I |
| InChI | InChI=1S/C13H19ClFN3.HI/c1-17(2)13(18(3)4)16-8-7-10-5-6-11(15)9-12(10)14;/h5-6,9H,7-8H2,1-4H3;1H |
| InChIKey | IYNIVZNYSJUUHA-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 18.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.68 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|