C18H16Cl2F2N2O2 — CID 166179956
N,N'-bis[(2-chloro-4-fluorophenyl)methyl]-N,N'-dimethyloxamide (PubChem CID 166179956) has the molecular formula C18H16Cl2F2N2O2 and a molecular weight of 401.24 g/mol. Its IUPAC name is N,N'-bis[(2-chloro-4-fluorophenyl)methyl]-N,N'-dimethyloxamide.
| Compound Name | N,N'-bis[(2-chloro-4-fluorophenyl)methyl]-N,N'-dimethyloxamide |
|---|---|
| PubChem CID | 166179956 |
| Molecular Formula | C18H16Cl2F2N2O2 |
| Molecular Weight | 401.24 g/mol |
| Exact Mass | 400.06 |
| IUPAC Name | N,N'-bis[(2-chloro-4-fluorophenyl)methyl]-N,N'-dimethyloxamide |
| SMILES | CN(Cc1ccc(F)cc1Cl)C(=O)C(=O)N(C)Cc1ccc(F)cc1Cl |
| InChI | InChI=1S/C18H16Cl2F2N2O2/c1-23(9-11-3-5-13(21)7-15(11)19)17(25)18(26)24(2)10-12-4-6-14(22)8-16(12)20/h3-8H,9-10H2,1-2H3 |
| InChIKey | KNNXIXNHCUAKNV-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.24 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|