C9H10ClFNO2S- — CID 70395698
2-chloro-4-fluoro-1-[2-[methyl(sulfinato)amino]ethyl]benzene (PubChem CID 70395698) has the molecular formula C9H10ClFNO2S- and a molecular weight of 250.70 g/mol. Its IUPAC name is 2-chloro-4-fluoro-1-[2-[methyl(sulfinato)amino]ethyl]benzene.
| Compound Name | 2-chloro-4-fluoro-1-[2-[methyl(sulfinato)amino]ethyl]benzene |
|---|---|
| PubChem CID | 70395698 |
| Molecular Formula | C9H10ClFNO2S- |
| Molecular Weight | 250.70 g/mol |
| Exact Mass | 250.01 |
| IUPAC Name | 2-chloro-4-fluoro-1-[2-[methyl(sulfinato)amino]ethyl]benzene |
| SMILES | CN(CCc1ccc(F)cc1Cl)S(=O)[O-] |
| InChI | InChI=1S/C9H11ClFNO2S/c1-12(15(13)14)5-4-7-2-3-8(11)6-9(7)10/h2-3,6H,4-5H2,1H3,(H,13,14)/p-1 |
| InChIKey | RCPBBKMYKSMNFR-UHFFFAOYSA-M |
| XLogP | 1.75 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.70 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|