C14H23N3O — CID 111044300
2-[(2-ethoxyphenyl)methyl]-1,1,3,3-tetramethylguanidine (PubChem CID 111044300) has the molecular formula C14H23N3O and a molecular weight of 249.36 g/mol. Its IUPAC name is 2-[(2-ethoxyphenyl)methyl]-1,1,3,3-tetramethylguanidine.
| Compound Name | 2-[(2-ethoxyphenyl)methyl]-1,1,3,3-tetramethylguanidine |
|---|---|
| PubChem CID | 111044300 |
| Molecular Formula | C14H23N3O |
| Molecular Weight | 249.36 g/mol |
| Exact Mass | 249.18 |
| IUPAC Name | 2-[(2-ethoxyphenyl)methyl]-1,1,3,3-tetramethylguanidine |
| SMILES | CCOc1ccccc1CN=C(N(C)C)N(C)C |
| InChI | InChI=1S/C14H23N3O/c1-6-18-13-10-8-7-9-12(13)11-15-14(16(2)3)17(4)5/h7-10H,6,11H2,1-5H3 |
| InChIKey | HVHHSROZNAFJHC-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 28.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.36 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|