About 1-(2-ethoxyphenyl)-N-methanidyl-N-methylmethanamine
1-(2-ethoxyphenyl)-N-methanidyl-N-methylmethanamine (PubChem CID 59280687) has the molecular formula C11H16NO-
and a molecular weight of 178.25 g/mol. Its IUPAC name is 1-(2-ethoxyphenyl)-N-methanidyl-N-methylmethanamine.
Molecular Properties
| Compound Name | 1-(2-ethoxyphenyl)-N-methanidyl-N-methylmethanamine |
| PubChem CID | 59280687 |
| Molecular Formula | C11H16NO- |
| Molecular Weight | 178.25 g/mol |
| Exact Mass | 178.12 |
| IUPAC Name | 1-(2-ethoxyphenyl)-N-methanidyl-N-methylmethanamine |
| SMILES | [CH2-]N(C)Cc1ccccc1OCC |
| InChI | InChI=1S/C11H16NO/c1-4-13-11-8-6-5-7-10(11)9-12(2)3/h5-8H,2,4,9H2,1,3H3/q-1 |
| InChIKey | LLBDCYOROMYVAE-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.25 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 1-(2-ethoxyphenyl)-N-methanidyl-N-methylmethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-ethoxyphenyl)-N-methanidyl-N-methylmethanamine?
The IUPAC name of 1-(2-ethoxyphenyl)-N-methanidyl-N-methylmethanamine (CID 59280687) is 1-(2-ethoxyphenyl)-N-methanidyl-N-methylmethanamine.
What is the SMILES notation for 1-(2-ethoxyphenyl)-N-methanidyl-N-methylmethanamine?
The canonical SMILES for 1-(2-ethoxyphenyl)-N-methanidyl-N-methylmethanamine is [CH2-]N(C)Cc1ccccc1OCC.
What is the InChIKey of 1-(2-ethoxyphenyl)-N-methanidyl-N-methylmethanamine?
The InChIKey is LLBDCYOROMYVAE-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16NO/c1-4-13-11-8-6-5-7-10(11)9-12(2)3/h5-8H,2,4,9H2,1,3H3/q-1.
What are the key properties of 1-(2-ethoxyphenyl)-N-methanidyl-N-methylmethanamine?
1-(2-ethoxyphenyl)-N-methanidyl-N-methylmethanamine has a molecular weight of 178.25 g/mol, XLogP of 2.31, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-ethoxyphenyl)-N-methanidyl-N-methylmethanamine is sourced from PubChem (CID 59280687), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).