C13H18ClN3O — CID 122095345
N'-[2-(3-chlorophenyl)-2-hydroxypropyl]azetidine-1-carboximidamide (PubChem CID 122095345) has the molecular formula C13H18ClN3O and a molecular weight of 267.76 g/mol. Its IUPAC name is N'-[2-(3-chlorophenyl)-2-hydroxypropyl]azetidine-1-carboximidamide.
| Compound Name | N'-[2-(3-chlorophenyl)-2-hydroxypropyl]azetidine-1-carboximidamide |
|---|---|
| PubChem CID | 122095345 |
| Molecular Formula | C13H18ClN3O |
| Molecular Weight | 267.76 g/mol |
| Exact Mass | 267.11 |
| IUPAC Name | N'-[2-(3-chlorophenyl)-2-hydroxypropyl]azetidine-1-carboximidamide |
| SMILES | CC(O)(C/N=C(\N)N1CCC1)c1cccc(Cl)c1 |
| InChI | InChI=1S/C13H18ClN3O/c1-13(18,10-4-2-5-11(14)8-10)9-16-12(15)17-6-3-7-17/h2,4-5,8,18H,3,6-7,9H2,1H3,(H2,15,16) |
| InChIKey | AIBSPIRRBUZDET-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 61.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.76 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|