C13H21N3OS — CID 111823981
N'-(2-hydroxy-2-thiophen-3-ylpropyl)piperidine-1-carboximidamide (PubChem CID 111823981) has the molecular formula C13H21N3OS and a molecular weight of 267.40 g/mol. Its IUPAC name is N'-(2-hydroxy-2-thiophen-3-ylpropyl)piperidine-1-carboximidamide.
| Compound Name | N'-(2-hydroxy-2-thiophen-3-ylpropyl)piperidine-1-carboximidamide |
|---|---|
| PubChem CID | 111823981 |
| Molecular Formula | C13H21N3OS |
| Molecular Weight | 267.40 g/mol |
| Exact Mass | 267.14 |
| IUPAC Name | N'-(2-hydroxy-2-thiophen-3-ylpropyl)piperidine-1-carboximidamide |
| SMILES | CC(O)(C/N=C(\N)N1CCCCC1)c1ccsc1 |
| InChI | InChI=1S/C13H21N3OS/c1-13(17,11-5-8-18-9-11)10-15-12(14)16-6-3-2-4-7-16/h5,8-9,17H,2-4,6-7,10H2,1H3,(H2,14,15) |
| InChIKey | YWIRXELCGBEVHF-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 61.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.40 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|