C17H29IN4O2S — CID 111654285
1-ethyl-3-(2-hydroxy-2-thiophen-3-ylpropyl)-2-(2-oxo-2-piperidin-1-ylethyl)guanidine;hydroiodide (PubChem CID 111654285) has the molecular formula C17H29IN4O2S and a molecular weight of 480.42 g/mol. Its IUPAC name is 1-ethyl-3-(2-hydroxy-2-thiophen-3-ylpropyl)-2-(2-oxo-2-piperidin-1-ylethyl)guanidine;hydroiodide.
| Compound Name | 1-ethyl-3-(2-hydroxy-2-thiophen-3-ylpropyl)-2-(2-oxo-2-piperidin-1-ylethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111654285 |
| Molecular Formula | C17H29IN4O2S |
| Molecular Weight | 480.42 g/mol |
| Exact Mass | 480.11 |
| IUPAC Name | 1-ethyl-3-(2-hydroxy-2-thiophen-3-ylpropyl)-2-(2-oxo-2-piperidin-1-ylethyl)guanidine;hydroiodide |
| SMILES | CCN/C(=N\CC(=O)N1CCCCC1)NCC(C)(O)c1ccsc1.I |
| InChI | InChI=1S/C17H28N4O2S.HI/c1-3-18-16(19-11-15(22)21-8-5-4-6-9-21)20-13-17(2,23)14-7-10-24-12-14;/h7,10,12,23H,3-6,8-9,11,13H2,1-2H3,(H2,18,19,20);1H |
| InChIKey | JNOUXTHMVQCGMY-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 76.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.42 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|