C19H34N4OS — CID 111654224
1-ethyl-3-(2-hydroxy-2-thiophen-3-ylpropyl)-2-(2-methyl-2-piperidin-1-ylpropyl)guanidine (PubChem CID 111654224) has the molecular formula C19H34N4OS and a molecular weight of 366.58 g/mol. Its IUPAC name is 1-ethyl-3-(2-hydroxy-2-thiophen-3-ylpropyl)-2-(2-methyl-2-piperidin-1-ylpropyl)guanidine.
| Compound Name | 1-ethyl-3-(2-hydroxy-2-thiophen-3-ylpropyl)-2-(2-methyl-2-piperidin-1-ylpropyl)guanidine |
|---|---|
| PubChem CID | 111654224 |
| Molecular Formula | C19H34N4OS |
| Molecular Weight | 366.58 g/mol |
| Exact Mass | 366.25 |
| IUPAC Name | 1-ethyl-3-(2-hydroxy-2-thiophen-3-ylpropyl)-2-(2-methyl-2-piperidin-1-ylpropyl)guanidine |
| SMILES | CCN/C(=N\CC(C)(C)N1CCCCC1)NCC(C)(O)c1ccsc1 |
| InChI | InChI=1S/C19H34N4OS/c1-5-20-17(22-15-19(4,24)16-9-12-25-13-16)21-14-18(2,3)23-10-7-6-8-11-23/h9,12-13,24H,5-8,10-11,14-15H2,1-4H3,(H2,20,21,22) |
| InChIKey | DUWQLPXLHPLIAT-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 59.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.58 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|