C10H15ClIN3S2 — CID 119119247
N'-[(5-chlorothiophen-2-yl)methyl]thiomorpholine-4-carboximidamide;hydroiodide (PubChem CID 119119247) has the molecular formula C10H15ClIN3S2 and a molecular weight of 403.74 g/mol. Its IUPAC name is N'-[(5-chlorothiophen-2-yl)methyl]thiomorpholine-4-carboximidamide;hydroiodide.
| Compound Name | N'-[(5-chlorothiophen-2-yl)methyl]thiomorpholine-4-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 119119247 |
| Molecular Formula | C10H15ClIN3S2 |
| Molecular Weight | 403.74 g/mol |
| Exact Mass | 402.94 |
| IUPAC Name | N'-[(5-chlorothiophen-2-yl)methyl]thiomorpholine-4-carboximidamide;hydroiodide |
| SMILES | I.N/C(=N\Cc1ccc(Cl)s1)N1CCSCC1 |
| InChI | InChI=1S/C10H14ClN3S2.HI/c11-9-2-1-8(16-9)7-13-10(12)14-3-5-15-6-4-14;/h1-2H,3-7H2,(H2,12,13);1H |
| InChIKey | MDOZDPGHRWNVDY-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 41.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.74 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|