C11H19IN4O2S2 — CID 111031033
N'-[(5-sulfamoylthiophen-2-yl)methyl]piperidine-1-carboximidamide;hydroiodide (PubChem CID 111031033) has the molecular formula C11H19IN4O2S2 and a molecular weight of 430.34 g/mol. Its IUPAC name is N'-[(5-sulfamoylthiophen-2-yl)methyl]piperidine-1-carboximidamide;hydroiodide.
| Compound Name | N'-[(5-sulfamoylthiophen-2-yl)methyl]piperidine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111031033 |
| Molecular Formula | C11H19IN4O2S2 |
| Molecular Weight | 430.34 g/mol |
| Exact Mass | 430.00 |
| IUPAC Name | N'-[(5-sulfamoylthiophen-2-yl)methyl]piperidine-1-carboximidamide;hydroiodide |
| SMILES | I.N/C(=N\Cc1ccc(S(N)(=O)=O)s1)N1CCCCC1 |
| InChI | InChI=1S/C11H18N4O2S2.HI/c12-11(15-6-2-1-3-7-15)14-8-9-4-5-10(18-9)19(13,16)17;/h4-5H,1-3,6-8H2,(H2,12,14)(H2,13,16,17);1H |
| InChIKey | MAOIYICZDVHPIY-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 101.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.34 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|