C13H22N4O2S2 — CID 100673370
1,1-dimethyl-2-[(5-piperidin-1-ylsulfonylthiophen-2-yl)methyl]guanidine (PubChem CID 100673370) has the molecular formula C13H22N4O2S2 and a molecular weight of 330.48 g/mol. Its IUPAC name is 1,1-dimethyl-2-[(5-piperidin-1-ylsulfonylthiophen-2-yl)methyl]guanidine.
| Compound Name | 1,1-dimethyl-2-[(5-piperidin-1-ylsulfonylthiophen-2-yl)methyl]guanidine |
|---|---|
| PubChem CID | 100673370 |
| Molecular Formula | C13H22N4O2S2 |
| Molecular Weight | 330.48 g/mol |
| Exact Mass | 330.12 |
| IUPAC Name | 1,1-dimethyl-2-[(5-piperidin-1-ylsulfonylthiophen-2-yl)methyl]guanidine |
| SMILES | CN(C)/C(N)=N/Cc1ccc(S(=O)(=O)N2CCCCC2)s1 |
| InChI | InChI=1S/C13H22N4O2S2/c1-16(2)13(14)15-10-11-6-7-12(20-11)21(18,19)17-8-4-3-5-9-17/h6-7H,3-5,8-10H2,1-2H3,(H2,14,15) |
| InChIKey | PDMAKBHFFBENFU-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 79.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.48 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|