C14H25IN4O2S2 — CID 111038588
2-[(5-piperidin-1-ylsulfonylthiophen-2-yl)methyl]-1-propan-2-ylguanidine;hydroiodide (PubChem CID 111038588) has the molecular formula C14H25IN4O2S2 and a molecular weight of 472.42 g/mol. Its IUPAC name is 2-[(5-piperidin-1-ylsulfonylthiophen-2-yl)methyl]-1-propan-2-ylguanidine;hydroiodide.
| Compound Name | 2-[(5-piperidin-1-ylsulfonylthiophen-2-yl)methyl]-1-propan-2-ylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111038588 |
| Molecular Formula | C14H25IN4O2S2 |
| Molecular Weight | 472.42 g/mol |
| Exact Mass | 472.05 |
| IUPAC Name | 2-[(5-piperidin-1-ylsulfonylthiophen-2-yl)methyl]-1-propan-2-ylguanidine;hydroiodide |
| SMILES | CC(C)N/C(N)=N/Cc1ccc(S(=O)(=O)N2CCCCC2)s1.I |
| InChI | InChI=1S/C14H24N4O2S2.HI/c1-11(2)17-14(15)16-10-12-6-7-13(21-12)22(19,20)18-8-4-3-5-9-18;/h6-7,11H,3-5,8-10H2,1-2H3,(H3,15,16,17);1H |
| InChIKey | BYVQIOGZDZIJMO-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 87.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.42 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|