C18H25IN4O3S2 — CID 111064253
1-(3,4-dimethylphenyl)-2-[(5-morpholin-4-ylsulfonylthiophen-2-yl)methyl]guanidine;hydroiodide (PubChem CID 111064253) has the molecular formula C18H25IN4O3S2 and a molecular weight of 536.46 g/mol. Its IUPAC name is 1-(3,4-dimethylphenyl)-2-[(5-morpholin-4-ylsulfonylthiophen-2-yl)methyl]guanidine;hydroiodide.
| Compound Name | 1-(3,4-dimethylphenyl)-2-[(5-morpholin-4-ylsulfonylthiophen-2-yl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111064253 |
| Molecular Formula | C18H25IN4O3S2 |
| Molecular Weight | 536.46 g/mol |
| Exact Mass | 536.04 |
| IUPAC Name | 1-(3,4-dimethylphenyl)-2-[(5-morpholin-4-ylsulfonylthiophen-2-yl)methyl]guanidine;hydroiodide |
| SMILES | Cc1ccc(N/C(N)=N/Cc2ccc(S(=O)(=O)N3CCOCC3)s2)cc1C.I |
| InChI | InChI=1S/C18H24N4O3S2.HI/c1-13-3-4-15(11-14(13)2)21-18(19)20-12-16-5-6-17(26-16)27(23,24)22-7-9-25-10-8-22;/h3-6,11H,7-10,12H2,1-2H3,(H3,19,20,21);1H |
| InChIKey | VGUCZXSRSJBXRB-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 97.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.46 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|