C15H19N5O3S2 — CID 119118993
2-[(5-morpholin-4-ylsulfonylthiophen-2-yl)methyl]-1-pyridin-2-ylguanidine (PubChem CID 119118993) has the molecular formula C15H19N5O3S2 and a molecular weight of 381.48 g/mol. Its IUPAC name is 2-[(5-morpholin-4-ylsulfonylthiophen-2-yl)methyl]-1-pyridin-2-ylguanidine.
| Compound Name | 2-[(5-morpholin-4-ylsulfonylthiophen-2-yl)methyl]-1-pyridin-2-ylguanidine |
|---|---|
| PubChem CID | 119118993 |
| Molecular Formula | C15H19N5O3S2 |
| Molecular Weight | 381.48 g/mol |
| Exact Mass | 381.09 |
| IUPAC Name | 2-[(5-morpholin-4-ylsulfonylthiophen-2-yl)methyl]-1-pyridin-2-ylguanidine |
| SMILES | N/C(=N\Cc1ccc(S(=O)(=O)N2CCOCC2)s1)Nc1ccccn1 |
| InChI | InChI=1S/C15H19N5O3S2/c16-15(19-13-3-1-2-6-17-13)18-11-12-4-5-14(24-12)25(21,22)20-7-9-23-10-8-20/h1-6H,7-11H2,(H3,16,17,18,19) |
| InChIKey | GMWRXSKTPBXIKT-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 109.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.48 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|