C14H24N4O3S2 — CID 111064256
1,1-diethyl-2-[(5-morpholin-4-ylsulfonylthiophen-2-yl)methyl]guanidine (PubChem CID 111064256) has the molecular formula C14H24N4O3S2 and a molecular weight of 360.51 g/mol. Its IUPAC name is 1,1-diethyl-2-[(5-morpholin-4-ylsulfonylthiophen-2-yl)methyl]guanidine.
| Compound Name | 1,1-diethyl-2-[(5-morpholin-4-ylsulfonylthiophen-2-yl)methyl]guanidine |
|---|---|
| PubChem CID | 111064256 |
| Molecular Formula | C14H24N4O3S2 |
| Molecular Weight | 360.51 g/mol |
| Exact Mass | 360.13 |
| IUPAC Name | 1,1-diethyl-2-[(5-morpholin-4-ylsulfonylthiophen-2-yl)methyl]guanidine |
| SMILES | CCN(CC)/C(N)=N/Cc1ccc(S(=O)(=O)N2CCOCC2)s1 |
| InChI | InChI=1S/C14H24N4O3S2/c1-3-17(4-2)14(15)16-11-12-5-6-13(22-12)23(19,20)18-7-9-21-10-8-18/h5-6H,3-4,7-11H2,1-2H3,(H2,15,16) |
| InChIKey | RPZHIEFFLJPGCI-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 88.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.51 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|